About 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine
3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine (PubChem CID 114128195) has the molecular formula C12H19F2N3O
and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine.
Molecular Properties
| Compound Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine |
| PubChem CID | 114128195 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine |
| SMILES | FC(F)COCCn1cncc1C1CCCNC1 |
| InChI | InChI=1S/C12H19F2N3O/c13-12(14)8-18-5-4-17-9-16-7-11(17)10-2-1-3-15-6-10/h7,9-10,12,15H,1-6,8H2 |
| InChIKey | JICBKRGUZAJDGB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine?
The IUPAC name of 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine (CID 114128195) is 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine.
What is the SMILES notation for 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine?
The canonical SMILES for 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine is FC(F)COCCn1cncc1C1CCCNC1.
What is the InChIKey of 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine?
The InChIKey is JICBKRGUZAJDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N3O/c13-12(14)8-18-5-4-17-9-16-7-11(17)10-2-1-3-15-6-10/h7,9-10,12,15H,1-6,8H2.
What are the key properties of 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine?
3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine has a molecular weight of 259.30 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine is sourced from PubChem (CID 114128195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).