C12H19F2N3O — CID 114128198
2-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine (PubChem CID 114128198) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine.
| Compound Name | 2-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114128198 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[3-[2-(2,2-difluoroethoxy)ethyl]imidazol-4-yl]piperidine |
| SMILES | FC(F)COCCn1cncc1C1CCCCN1 |
| InChI | InChI=1S/C12H19F2N3O/c13-12(14)8-18-6-5-17-9-15-7-11(17)10-3-1-2-4-16-10/h7,9-10,12,16H,1-6,8H2 |
| InChIKey | OMCYXHZABMIOLU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|