C12H21N3S2 — CID 114128261
N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-piperidin-4-ylsulfanylethanamine (PubChem CID 114128261) has the molecular formula C12H21N3S2 and a molecular weight of 271.45 g/mol. Its IUPAC name is N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-piperidin-4-ylsulfanylethanamine.
| Compound Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-piperidin-4-ylsulfanylethanamine |
|---|---|
| PubChem CID | 114128261 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]-2-piperidin-4-ylsulfanylethanamine |
| SMILES | Cc1cnc(CNCCSC2CCNCC2)s1 |
| InChI | InChI=1S/C12H21N3S2/c1-10-8-15-12(17-10)9-14-6-7-16-11-2-4-13-5-3-11/h8,11,13-14H,2-7,9H2,1H3 |
| InChIKey | HYOXBGXMHYNCBZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|