About 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine
5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 114128323) has the molecular formula C13H13N3S2
and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine |
| PubChem CID | 114128323 |
| Molecular Formula | C13H13N3S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2sc(NCc3ncc(C)s3)nc2c1 |
| InChI | InChI=1S/C13H13N3S2/c1-8-3-4-11-10(5-8)16-13(18-11)15-7-12-14-6-9(2)17-12/h3-6H,7H2,1-2H3,(H,15,16) |
| InChIKey | PWDPFYHIMGOKIU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine?
The IUPAC name of 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine (CID 114128323) is 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine.
What is the SMILES notation for 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine?
The canonical SMILES for 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine is Cc1ccc2sc(NCc3ncc(C)s3)nc2c1.
What is the InChIKey of 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine?
The InChIKey is PWDPFYHIMGOKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3S2/c1-8-3-4-11-10(5-8)16-13(18-11)15-7-12-14-6-9(2)17-12/h3-6H,7H2,1-2H3,(H,15,16).
What are the key properties of 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine?
5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine has a molecular weight of 275.40 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 114128323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).