C13H20F2N2O — CID 114128441
1-[2-(2,2-difluoroethoxy)ethyl]-2-methyl-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 114128441) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-2-methyl-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-methyl-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 114128441 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-2-methyl-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | Cc1cc2c(n1CCOCC(F)F)CCCC2N |
| InChI | InChI=1S/C13H20F2N2O/c1-9-7-10-11(16)3-2-4-12(10)17(9)5-6-18-8-13(14)15/h7,11,13H,2-6,8,16H2,1H3 |
| InChIKey | KQYKXQMTHJDCPW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|