About 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile
2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile (PubChem CID 114128591) has the molecular formula C13H16N4S
and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile |
| PubChem CID | 114128591 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile |
| SMILES | CCc1cnc(Cn2c(C)c(C)c(C#N)c2N)s1 |
| InChI | InChI=1S/C13H16N4S/c1-4-10-6-16-12(18-10)7-17-9(3)8(2)11(5-14)13(17)15/h6H,4,7,15H2,1-3H3 |
| InChIKey | AHXLXDHPLMYOLL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile?
The IUPAC name of 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile (CID 114128591) is 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile.
What is the SMILES notation for 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile?
The canonical SMILES for 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile is CCc1cnc(Cn2c(C)c(C)c(C#N)c2N)s1.
What is the InChIKey of 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile?
The InChIKey is AHXLXDHPLMYOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4S/c1-4-10-6-16-12(18-10)7-17-9(3)8(2)11(5-14)13(17)15/h6H,4,7,15H2,1-3H3.
What are the key properties of 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile?
2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile has a molecular weight of 260.37 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-4,5-dimethylpyrrole-3-carbonitrile is sourced from PubChem (CID 114128591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).