C12H17F2NO2 — CID 114128615
1-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 114128615) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 114128615 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2CCOCC(F)F |
| InChI | InChI=1S/C12H17F2NO2/c13-12(14)8-17-7-6-15-5-4-9-10(15)2-1-3-11(9)16/h4-5,11-12,16H,1-3,6-8H2 |
| InChIKey | USWZLQRYBBTCJL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|