About 1,3-dimethylimidazol-1-ium;methanesulfonate
1,3-dimethylimidazol-1-ium;methanesulfonate (PubChem CID 11412872) has the molecular formula C6H12N2O3S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 1,3-dimethylimidazol-1-ium;methanesulfonate.
Molecular Properties
| Compound Name | 1,3-dimethylimidazol-1-ium;methanesulfonate |
| PubChem CID | 11412872 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1,3-dimethylimidazol-1-ium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].Cn1cc[n+](C)c1 |
| InChI | InChI=1S/C5H9N2.CH4O3S/c1-6-3-4-7(2)5-6;1-5(2,3)4/h3-5H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | CUCZSYMTPDSMEL-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylimidazol-1-ium;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazol-1-ium;methanesulfonate?
The IUPAC name of 1,3-dimethylimidazol-1-ium;methanesulfonate (CID 11412872) is 1,3-dimethylimidazol-1-ium;methanesulfonate.
What is the SMILES notation for 1,3-dimethylimidazol-1-ium;methanesulfonate?
The canonical SMILES for 1,3-dimethylimidazol-1-ium;methanesulfonate is CS(=O)(=O)[O-].Cn1cc[n+](C)c1.
What is the InChIKey of 1,3-dimethylimidazol-1-ium;methanesulfonate?
The InChIKey is CUCZSYMTPDSMEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9N2.CH4O3S/c1-6-3-4-7(2)5-6;1-5(2,3)4/h3-5H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 1,3-dimethylimidazol-1-ium;methanesulfonate?
1,3-dimethylimidazol-1-ium;methanesulfonate has a molecular weight of 192.24 g/mol, XLogP of -0.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazol-1-ium;methanesulfonate is sourced from PubChem (CID 11412872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).