C9H12F2N2O5 — CID 114128896
5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 114128896) has the molecular formula C9H12F2N2O5 and a molecular weight of 266.20 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 114128896 |
| Molecular Formula | C9H12F2N2O5 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)NCCOCC(F)F)C1 |
| InChI | InChI=1S/C9H12F2N2O5/c10-7(11)4-17-2-1-12-8(14)6-3-5(9(15)16)13-18-6/h6-7H,1-4H2,(H,12,14)(H,15,16) |
| InChIKey | PPIIKWAROYMDJC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|