C9H9F5N2OS — CID 114129313
2,2,3,3,3-pentafluoro-N-[2-(1,3-thiazol-2-yl)propyl]propanamide (PubChem CID 114129313) has the molecular formula C9H9F5N2OS and a molecular weight of 288.24 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(1,3-thiazol-2-yl)propyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(1,3-thiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 114129313 |
| Molecular Formula | C9H9F5N2OS |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(1,3-thiazol-2-yl)propyl]propanamide |
| SMILES | CC(CNC(=O)C(F)(F)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C9H9F5N2OS/c1-5(6-15-2-3-18-6)4-16-7(17)8(10,11)9(12,13)14/h2-3,5H,4H2,1H3,(H,16,17) |
| InChIKey | BERJHPWKILCIKG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|