About triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane
triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane (PubChem CID 11412957) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane |
| PubChem CID | 11412957 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane |
| SMILES | C=C(/C=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H22OSi/c1-6-10-11(5)12-13(7-2,8-3)9-4/h6,10H,5,7-9H2,1-4H3/b10-6+ |
| InChIKey | ICUOJUZGDQZQRW-UXBLZVDNSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane?
The IUPAC name of triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane (CID 11412957) is triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane.
What is the SMILES notation for triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane?
The canonical SMILES for triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane is C=C(/C=C/C)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane?
The InChIKey is ICUOJUZGDQZQRW-UXBLZVDNSA-N. The full InChI is InChI=1S/C11H22OSi/c1-6-10-11(5)12-13(7-2,8-3)9-4/h6,10H,5,7-9H2,1-4H3/b10-6+.
What are the key properties of triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane?
triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane has a molecular weight of 198.38 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(3E)-penta-1,3-dien-2-yl]oxysilane is sourced from PubChem (CID 11412957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).