C9H10F3NO4S2 — CID 114129755
4-(4,4,4-trifluorobutan-2-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 114129755) has the molecular formula C9H10F3NO4S2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114129755 |
| Molecular Formula | C9H10F3NO4S2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10F3NO4S2/c1-5(3-9(10,11)12)13-19(16,17)6-2-7(8(14)15)18-4-6/h2,4-5,13H,3H2,1H3,(H,14,15) |
| InChIKey | AFAUVQUCBFCKMT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |