C14H30N2O — CID 114130039
1-(5-methoxypentyl)-3,7-dimethyl-1,5-diazocane (PubChem CID 114130039) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(5-methoxypentyl)-3,7-dimethyl-1,5-diazocane.
| Compound Name | 1-(5-methoxypentyl)-3,7-dimethyl-1,5-diazocane |
|---|---|
| PubChem CID | 114130039 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-(5-methoxypentyl)-3,7-dimethyl-1,5-diazocane |
| SMILES | COCCCCCN1CC(C)CNCC(C)C1 |
| InChI | InChI=1S/C14H30N2O/c1-13-9-15-10-14(2)12-16(11-13)7-5-4-6-8-17-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | NPYHDLGITGFHJL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|