C12H21F3N2 — CID 114130546
2,2-dimethyl-6-(4,4,4-trifluorobutan-2-ylamino)hexanenitrile (PubChem CID 114130546) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4,4,4-trifluorobutan-2-ylamino)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(4,4,4-trifluorobutan-2-ylamino)hexanenitrile |
|---|---|
| PubChem CID | 114130546 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,2-dimethyl-6-(4,4,4-trifluorobutan-2-ylamino)hexanenitrile |
| SMILES | CC(CC(F)(F)F)NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C12H21F3N2/c1-10(8-12(13,14)15)17-7-5-4-6-11(2,3)9-16/h10,17H,4-8H2,1-3H3 |
| InChIKey | WLKQRLSVFPTRCL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|