C10H10ClF3N2O2 — CID 114131107
2-chloro-6-(4,4,4-trifluorobutan-2-ylamino)pyridine-4-carboxylic acid (PubChem CID 114131107) has the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.65 g/mol. Its IUPAC name is 2-chloro-6-(4,4,4-trifluorobutan-2-ylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(4,4,4-trifluorobutan-2-ylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114131107 |
| Molecular Formula | C10H10ClF3N2O2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-chloro-6-(4,4,4-trifluorobutan-2-ylamino)pyridine-4-carboxylic acid |
| SMILES | CC(CC(F)(F)F)Nc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C10H10ClF3N2O2/c1-5(4-10(12,13)14)15-8-3-6(9(17)18)2-7(11)16-8/h2-3,5H,4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ASMIOBZEUDYIER-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|