C10H16N2O4S — CID 114132074
N-(2-ethoxyethyl)-5-(hydroxymethyl)pyridine-2-sulfonamide (PubChem CID 114132074) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-(hydroxymethyl)pyridine-2-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-5-(hydroxymethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 114132074 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-(2-ethoxyethyl)-5-(hydroxymethyl)pyridine-2-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1ccc(CO)cn1 |
| InChI | InChI=1S/C10H16N2O4S/c1-2-16-6-5-12-17(14,15)10-4-3-9(8-13)7-11-10/h3-4,7,12-13H,2,5-6,8H2,1H3 |
| InChIKey | HXHBSPKDGMZYNB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|