C17H22N2O3S2 — CID 114132627
N-(1-benzylpiperidin-4-yl)-2-(hydroxymethyl)thiophene-3-sulfonamide (PubChem CID 114132627) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(hydroxymethyl)thiophene-3-sulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(hydroxymethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114132627 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(hydroxymethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(Cc2ccccc2)CC1)c1ccsc1CO |
| InChI | InChI=1S/C17H22N2O3S2/c20-13-16-17(8-11-23-16)24(21,22)18-15-6-9-19(10-7-15)12-14-4-2-1-3-5-14/h1-5,8,11,15,18,20H,6-7,9-10,12-13H2 |
| InChIKey | BZPWPDOANFBFDN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |