C14H22O2 — CID 11413407
(1R,2R,5S,6R,8S)-2,6-dimethyl-3-methylidene-1-prop-2-enylbicyclo[3.2.1]octane-2,8-diol (PubChem CID 11413407) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,2R,5S,6R,8S)-2,6-dimethyl-3-methylidene-1-prop-2-enylbicyclo[3.2.1]octane-2,8-diol.
| Compound Name | (1R,2R,5S,6R,8S)-2,6-dimethyl-3-methylidene-1-prop-2-enylbicyclo[3.2.1]octane-2,8-diol |
|---|---|
| PubChem CID | 11413407 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,2R,5S,6R,8S)-2,6-dimethyl-3-methylidene-1-prop-2-enylbicyclo[3.2.1]octane-2,8-diol |
| SMILES | C=CC[C@]12C[C@@H](C)[C@H](CC(=C)[C@@]1(C)O)[C@@H]2O |
| InChI | InChI=1S/C14H22O2/c1-5-6-14-8-9(2)11(12(14)15)7-10(3)13(14,4)16/h5,9,11-12,15-16H,1,3,6-8H2,2,4H3/t9-,11+,12+,13-,14-/m1/s1 |
| InChIKey | OJQZRCGUXRAADJ-FYGCWZCISA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|