About N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine
N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine (PubChem CID 114134141) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine |
| PubChem CID | 114134141 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CC)CCNc1nc(C)cnc1C |
| InChI | InChI=1S/C13H24N4/c1-5-8-17(6-2)9-7-14-13-12(4)15-10-11(3)16-13/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | USDDNQFKXJXDQX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine?
The IUPAC name of N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine (CID 114134141) is N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine.
What is the SMILES notation for N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine?
The canonical SMILES for N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine is CCCN(CC)CCNc1nc(C)cnc1C.
What is the InChIKey of N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine?
The InChIKey is USDDNQFKXJXDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-5-8-17(6-2)9-7-14-13-12(4)15-10-11(3)16-13/h10H,5-9H2,1-4H3,(H,14,16).
What are the key properties of N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine?
N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine has a molecular weight of 236.36 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dimethylpyrazin-2-yl)-N'-ethyl-N'-propylethane-1,2-diamine is sourced from PubChem (CID 114134141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).