C12H19N5 — CID 114135100
N'-ethyl-N-(1H-imidazo[4,5-b]pyridin-7-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 114135100) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is N'-ethyl-N-(1H-imidazo[4,5-b]pyridin-7-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N-(1H-imidazo[4,5-b]pyridin-7-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 114135100 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N'-ethyl-N-(1H-imidazo[4,5-b]pyridin-7-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNCc1ccnc2nc[nH]c12 |
| InChI | InChI=1S/C12H19N5/c1-3-17(2)7-6-13-8-10-4-5-14-12-11(10)15-9-16-12/h4-5,9,13H,3,6-8H2,1-2H3,(H,14,15,16) |
| InChIKey | ZUDRDBZUIYGHHI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|