About 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one
2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 11413589) has the molecular formula C9H11BrO2
and a molecular weight of 231.09 g/mol. Its IUPAC name is 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| PubChem CID | 11413589 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | O=C1CCCC2=C1CC(CBr)O2 |
| InChI | InChI=1S/C9H11BrO2/c10-5-6-4-7-8(11)2-1-3-9(7)12-6/h6H,1-5H2 |
| InChIKey | DMWDTIHJQVSXLG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The IUPAC name of 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (CID 11413589) is 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
What is the SMILES notation for 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The canonical SMILES for 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is O=C1CCCC2=C1CC(CBr)O2.
What is the InChIKey of 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
The InChIKey is DMWDTIHJQVSXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO2/c10-5-6-4-7-8(11)2-1-3-9(7)12-6/h6H,1-5H2.
What are the key properties of 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one?
2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one has a molecular weight of 231.09 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one is sourced from PubChem (CID 11413589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).