About ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate
ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate (PubChem CID 11413596) has the molecular formula C7H9N3O2S2
and a molecular weight of 231.30 g/mol. Its IUPAC name is ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate |
| PubChem CID | 11413596 |
| Molecular Formula | C7H9N3O2S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C7H9N3O2S2/c1-2-12-7(11)10-5(13)9-6-8-3-4-14-6/h3-4H,2H2,1H3,(H2,8,9,10,11,13) |
| InChIKey | SAWXOPRCFFDKPL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate?
The IUPAC name of ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate (CID 11413596) is ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate.
What is the SMILES notation for ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate?
The canonical SMILES for ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate is CCOC(=O)NC(=S)Nc1nccs1.
What is the InChIKey of ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate?
The InChIKey is SAWXOPRCFFDKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2S2/c1-2-12-7(11)10-5(13)9-6-8-3-4-14-6/h3-4H,2H2,1H3,(H2,8,9,10,11,13).
What are the key properties of ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate?
ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate has a molecular weight of 231.30 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1,3-thiazol-2-ylcarbamothioyl)carbamate is sourced from PubChem (CID 11413596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).