C13H17N2O2 — CID 11413631
4-Phenyl-2,2,5,5-tetramethyl-3-imidazoline-3-oxide-1-oxyl (PubChem CID 11413631) has the molecular formula C13H17N2O2 and a molecular weight of 233.29 g/mol.
| Compound Name | 4-Phenyl-2,2,5,5-tetramethyl-3-imidazoline-3-oxide-1-oxyl |
|---|---|
| PubChem CID | 11413631 |
| Molecular Formula | C13H17N2O2 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | — |
| SMILES | CC1(C)C(c2ccccc2)=[N+]([O-])C(C)(C)N1[O] |
| InChI | InChI=1S/C13H17N2O2/c1-12(2)11(10-8-6-5-7-9-10)14(16)13(3,4)15(12)17/h5-9H,1-4H3 |
| InChIKey | ZWDCBKCWJMCKOF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|