C11H18N2O3S2 — CID 114137985
5-(hydroxymethyl)-N-[(1-methylpyrrolidin-2-yl)methyl]thiophene-2-sulfonamide (PubChem CID 114137985) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-[(1-methylpyrrolidin-2-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-[(1-methylpyrrolidin-2-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114137985 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-(hydroxymethyl)-N-[(1-methylpyrrolidin-2-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CN1CCCC1CNS(=O)(=O)c1ccc(CO)s1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-13-6-2-3-9(13)7-12-18(15,16)11-5-4-10(8-14)17-11/h4-5,9,12,14H,2-3,6-8H2,1H3 |
| InChIKey | SEUFWHQVYQHIPU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |