C16H30N2 — CID 114138041
N-[(1,2,5-trimethylpyrrol-3-yl)methyl]octan-4-amine (PubChem CID 114138041) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N-[(1,2,5-trimethylpyrrol-3-yl)methyl]octan-4-amine.
| Compound Name | N-[(1,2,5-trimethylpyrrol-3-yl)methyl]octan-4-amine |
|---|---|
| PubChem CID | 114138041 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N-[(1,2,5-trimethylpyrrol-3-yl)methyl]octan-4-amine |
| SMILES | CCCCC(CCC)NCc1cc(C)n(C)c1C |
| InChI | InChI=1S/C16H30N2/c1-6-8-10-16(9-7-2)17-12-15-11-13(3)18(5)14(15)4/h11,16-17H,6-10,12H2,1-5H3 |
| InChIKey | JQZKLLPWDWVXOX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |