C14H16N2O2 — CID 11413862
8-(methylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid (PubChem CID 11413862) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8-(methylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid.
| Compound Name | 8-(methylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 11413862 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 8-(methylamino)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid |
| SMILES | CNc1ccc2c(c1)C1C=CCC1C(C(=O)O)N2 |
| InChI | InChI=1S/C14H16N2O2/c1-15-8-5-6-12-11(7-8)9-3-2-4-10(9)13(16-12)14(17)18/h2-3,5-7,9-10,13,15-16H,4H2,1H3,(H,17,18) |
| InChIKey | ZEQCQLFNPGSPEB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|