C12H15BrN2O3S — CID 114139760
2-[2-(5-bromothiophen-2-yl)ethylcarbamoyl-prop-2-enylamino]acetic acid (PubChem CID 114139760) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethylcarbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethylcarbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 114139760 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethylcarbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H15BrN2O3S/c1-2-7-15(8-11(16)17)12(18)14-6-5-9-3-4-10(13)19-9/h2-4H,1,5-8H2,(H,14,18)(H,16,17) |
| InChIKey | WKBYNBAZZYZIIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|