C15H24O3 — CID 11414088
(E,3S,4S,7S)-3,7-dimethyl-8-(oxan-2-yloxy)oct-5-en-1-yn-4-ol (PubChem CID 11414088) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (E,3S,4S,7S)-3,7-dimethyl-8-(oxan-2-yloxy)oct-5-en-1-yn-4-ol.
| Compound Name | (E,3S,4S,7S)-3,7-dimethyl-8-(oxan-2-yloxy)oct-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11414088 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (E,3S,4S,7S)-3,7-dimethyl-8-(oxan-2-yloxy)oct-5-en-1-yn-4-ol |
| SMILES | C#C[C@H](C)[C@@H](O)/C=C/[C@H](C)COC1CCCCO1 |
| InChI | InChI=1S/C15H24O3/c1-4-13(3)14(16)9-8-12(2)11-18-15-7-5-6-10-17-15/h1,8-9,12-16H,5-7,10-11H2,2-3H3/b9-8+/t12-,13-,14-,15?/m0/s1 |
| InChIKey | IVDFOHHQEOPQGL-RUGJPHQKSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|