About N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide (PubChem CID 11414131) has the molecular formula C11H14N2O3S
and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide |
| PubChem CID | 11414131 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide |
| SMILES | CC(=O)NC1Cc2ccc(S(N)(=O)=O)cc2C1 |
| InChI | InChI=1S/C11H14N2O3S/c1-7(14)13-10-4-8-2-3-11(17(12,15)16)6-9(8)5-10/h2-3,6,10H,4-5H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | RVPDXKXWYPPTAL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide?
The IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide (CID 11414131) is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide.
What is the SMILES notation for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide?
The canonical SMILES for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide is CC(=O)NC1Cc2ccc(S(N)(=O)=O)cc2C1.
What is the InChIKey of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide?
The InChIKey is RVPDXKXWYPPTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c1-7(14)13-10-4-8-2-3-11(17(12,15)16)6-9(8)5-10/h2-3,6,10H,4-5H2,1H3,(H,13,14)(H2,12,15,16).
What are the key properties of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide?
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide has a molecular weight of 254.31 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)acetamide is sourced from PubChem (CID 11414131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).