About methyl 2-hydroxy-2,2-dithiophen-2-ylacetate
methyl 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 11414137) has the molecular formula C11H10O3S2
and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 2-hydroxy-2,2-dithiophen-2-ylacetate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| PubChem CID | 11414137 |
| Molecular Formula | C11H10O3S2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | methyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | COC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C11H10O3S2/c1-14-10(12)11(13,8-4-2-6-15-8)9-5-3-7-16-9/h2-7,13H,1H3 |
| InChIKey | SYHWYWHVEQQDMO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-hydroxy-2,2-dithiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The IUPAC name of methyl 2-hydroxy-2,2-dithiophen-2-ylacetate (CID 11414137) is methyl 2-hydroxy-2,2-dithiophen-2-ylacetate.
What is the SMILES notation for methyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The canonical SMILES for methyl 2-hydroxy-2,2-dithiophen-2-ylacetate is COC(=O)C(O)(c1cccs1)c1cccs1.
What is the InChIKey of methyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The InChIKey is SYHWYWHVEQQDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3S2/c1-14-10(12)11(13,8-4-2-6-15-8)9-5-3-7-16-9/h2-7,13H,1H3.
What are the key properties of methyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
methyl 2-hydroxy-2,2-dithiophen-2-ylacetate has a molecular weight of 254.33 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-2,2-dithiophen-2-ylacetate is sourced from PubChem (CID 11414137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).