C15H19NOSi — CID 11414219
(1R,5R,8R)-8-[dimethyl(phenyl)silyl]-6-azabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 11414219) has the molecular formula C15H19NOSi and a molecular weight of 257.41 g/mol. Its IUPAC name is (1R,5R,8R)-8-[dimethyl(phenyl)silyl]-6-azabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (1R,5R,8R)-8-[dimethyl(phenyl)silyl]-6-azabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 11414219 |
| Molecular Formula | C15H19NOSi |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (1R,5R,8R)-8-[dimethyl(phenyl)silyl]-6-azabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1[C@@H]2CC=C[C@H]1NC2=O |
| InChI | InChI=1S/C15H19NOSi/c1-18(2,11-7-4-3-5-8-11)14-12-9-6-10-13(14)16-15(12)17/h3-8,10,12-14H,9H2,1-2H3,(H,16,17)/t12-,13+,14+/m0/s1 |
| InChIKey | VWPYGCUOFYYGLY-BFHYXJOUSA-N |
| XLogP | 2.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|