C10H17N5O2S — CID 114142213
4-(cyclopropylamino)-N-(1,2,4-triazin-3-yl)butane-1-sulfonamide (PubChem CID 114142213) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(1,2,4-triazin-3-yl)butane-1-sulfonamide.
| Compound Name | 4-(cyclopropylamino)-N-(1,2,4-triazin-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114142213 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-(cyclopropylamino)-N-(1,2,4-triazin-3-yl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCNC1CC1)Nc1nccnn1 |
| InChI | InChI=1S/C10H17N5O2S/c16-18(17,15-10-12-6-7-13-14-10)8-2-1-5-11-9-3-4-9/h6-7,9,11H,1-5,8H2,(H,12,14,15) |
| InChIKey | HGBXBOUNXISDSY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|