C14H26O4 — CID 11414241
(4S,5S,7R,8S)-5,7-dihydroxy-4,6,8-trimethylundecane-3,9-dione (PubChem CID 11414241) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4S,5S,7R,8S)-5,7-dihydroxy-4,6,8-trimethylundecane-3,9-dione.
| Compound Name | (4S,5S,7R,8S)-5,7-dihydroxy-4,6,8-trimethylundecane-3,9-dione |
|---|---|
| PubChem CID | 11414241 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (4S,5S,7R,8S)-5,7-dihydroxy-4,6,8-trimethylundecane-3,9-dione |
| SMILES | CCC(=O)[C@@H](C)[C@H](O)C(C)[C@H](O)[C@H](C)C(=O)CC |
| InChI | InChI=1S/C14H26O4/c1-6-11(15)8(3)13(17)10(5)14(18)9(4)12(16)7-2/h8-10,13-14,17-18H,6-7H2,1-5H3/t8-,9-,10?,13-,14+/m1/s1 |
| InChIKey | JMWOYWGZBVDUGI-FTJHFFLASA-N |
| XLogP | 1.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |