C12H22N2O4 — CID 114143542
4-(ethylamino)-N-[(3-hydroxyoxolan-3-yl)methyl]oxolane-3-carboxamide (PubChem CID 114143542) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(ethylamino)-N-[(3-hydroxyoxolan-3-yl)methyl]oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-[(3-hydroxyoxolan-3-yl)methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 114143542 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4-(ethylamino)-N-[(3-hydroxyoxolan-3-yl)methyl]oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C12H22N2O4/c1-2-13-10-6-18-5-9(10)11(15)14-7-12(16)3-4-17-8-12/h9-10,13,16H,2-8H2,1H3,(H,14,15) |
| InChIKey | USEFPIKXVXYEGW-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |