C14H17NO4 — CID 11414364
benzyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11414364) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is benzyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11414364 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | benzyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)OC[C@H](C=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-14(2)15(12(8-16)10-19-14)13(17)18-9-11-6-4-3-5-7-11/h3-8,12H,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | HMOZTZIZWRRDMM-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|