C13H19NO4 — CID 114143758
3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 114143758) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 114143758 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-[(3-hydroxy-2-methyloxolan-3-yl)methyl]-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC1OCCC1(O)CN1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C13H19NO4/c1-8-13(17,4-5-18-8)7-14-11(15)9-2-3-10(6-9)12(14)16/h8-10,17H,2-7H2,1H3 |
| InChIKey | FOIIPYUMNVPHOJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|