C17H28O2 — CID 11414413
(4R,5R,6R)-6-methoxy-5-[(E)-4-methoxy-2-methylbut-3-en-2-yl]-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 11414413) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (4R,5R,6R)-6-methoxy-5-[(E)-4-methoxy-2-methylbut-3-en-2-yl]-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R,5R,6R)-6-methoxy-5-[(E)-4-methoxy-2-methylbut-3-en-2-yl]-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 11414413 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (4R,5R,6R)-6-methoxy-5-[(E)-4-methoxy-2-methylbut-3-en-2-yl]-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@H](OC)[C@H]1C(C)(C)/C=C/OC |
| InChI | InChI=1S/C17H28O2/c1-12(2)14-9-8-13(3)16(19-7)15(14)17(4,5)10-11-18-6/h8,10-11,14-16H,1,9H2,2-7H3/b11-10+/t14-,15-,16-/m0/s1 |
| InChIKey | JFRVVDPPWVZNIU-OCARLFBBSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|