C12H14N2O4 — CID 114144840
5-methoxy-3-(4-methoxyphenyl)-1,3-diazinane-2,4-dione (PubChem CID 114144840) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-methoxy-3-(4-methoxyphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-methoxy-3-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 114144840 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-methoxy-3-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(N2C(=O)NCC(OC)C2=O)cc1 |
| InChI | InChI=1S/C12H14N2O4/c1-17-9-5-3-8(4-6-9)14-11(15)10(18-2)7-13-12(14)16/h3-6,10H,7H2,1-2H3,(H,13,16) |
| InChIKey | XRSJTZGDFNKVHZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |