About 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid
2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid (PubChem CID 114144842) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid |
| PubChem CID | 114144842 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid |
| SMILES | COC(CN1CCc2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C13H15NO4/c1-18-11(13(16)17)8-14-7-6-9-4-2-3-5-10(9)12(14)15/h2-5,11H,6-8H2,1H3,(H,16,17) |
| InChIKey | SSWOHCKQKWPHPU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid?
The IUPAC name of 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid (CID 114144842) is 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid.
What is the SMILES notation for 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid?
The canonical SMILES for 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid is COC(CN1CCc2ccccc2C1=O)C(=O)O.
What is the InChIKey of 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid?
The InChIKey is SSWOHCKQKWPHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-18-11(13(16)17)8-14-7-6-9-4-2-3-5-10(9)12(14)15/h2-5,11H,6-8H2,1H3,(H,16,17).
What are the key properties of 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid?
2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid has a molecular weight of 249.27 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(1-oxo-3,4-dihydroisoquinolin-2-yl)propanoic acid is sourced from PubChem (CID 114144842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).