C14H24N2O2 — CID 114145307
1-[2-[2-(2-hydroxyethyl)pentylamino]ethyl]pyridin-2-one (PubChem CID 114145307) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[2-[2-(2-hydroxyethyl)pentylamino]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[2-(2-hydroxyethyl)pentylamino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 114145307 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-[2-[2-(2-hydroxyethyl)pentylamino]ethyl]pyridin-2-one |
| SMILES | CCCC(CCO)CNCCn1ccccc1=O |
| InChI | InChI=1S/C14H24N2O2/c1-2-5-13(7-11-17)12-15-8-10-16-9-4-3-6-14(16)18/h3-4,6,9,13,15,17H,2,5,7-8,10-12H2,1H3 |
| InChIKey | LAXNQBQOQRLNAZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|