About N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine
N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine (PubChem CID 114145626) has the molecular formula C12H18F2N2O
and a molecular weight of 244.28 g/mol. Its IUPAC name is N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
| PubChem CID | 114145626 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
| SMILES | Cc1cnc(C(C)NCC2CCC(F)(F)C2)o1 |
| InChI | InChI=1S/C12H18F2N2O/c1-8-6-16-11(17-8)9(2)15-7-10-3-4-12(13,14)5-10/h6,9-10,15H,3-5,7H2,1-2H3 |
| InChIKey | QJCBLGNYANNJMG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The IUPAC name of N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine (CID 114145626) is N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine.
What is the SMILES notation for N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The canonical SMILES for N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine is Cc1cnc(C(C)NCC2CCC(F)(F)C2)o1.
What is the InChIKey of N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The InChIKey is QJCBLGNYANNJMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2O/c1-8-6-16-11(17-8)9(2)15-7-10-3-4-12(13,14)5-10/h6,9-10,15H,3-5,7H2,1-2H3.
What are the key properties of N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine has a molecular weight of 244.28 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-difluorocyclopentyl)methyl]-1-(5-methyl-1,3-oxazol-2-yl)ethanamine is sourced from PubChem (CID 114145626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).