C12H23NO4S — CID 114146309
N-[(4-hydroxycyclohexyl)methyl]-2-methyl-2-methylsulfonylpropanamide (PubChem CID 114146309) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is N-[(4-hydroxycyclohexyl)methyl]-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-[(4-hydroxycyclohexyl)methyl]-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 114146309 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[(4-hydroxycyclohexyl)methyl]-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)(C(=O)NCC1CCC(O)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C12H23NO4S/c1-12(2,18(3,16)17)11(15)13-8-9-4-6-10(14)7-5-9/h9-10,14H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | WFXRXYSALIWKJW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |