C18H26O2 — CID 11414665
(1R,2S,5S,9S,10R,12R,14R)-2-hydroxy-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-7-en-15-one (PubChem CID 11414665) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1R,2S,5S,9S,10R,12R,14R)-2-hydroxy-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-7-en-15-one.
| Compound Name | (1R,2S,5S,9S,10R,12R,14R)-2-hydroxy-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-7-en-15-one |
|---|---|
| PubChem CID | 11414665 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1R,2S,5S,9S,10R,12R,14R)-2-hydroxy-11,11,14-trimethyltetracyclo[7.5.1.01,5.010,12]pentadec-7-en-15-one |
| SMILES | C[C@@H]1C[C@@H]2[C@H]([C@@H]3C=CC[C@@H]4CC[C@H](O)[C@]41C3=O)C2(C)C |
| InChI | InChI=1S/C18H26O2/c1-10-9-13-15(17(13,2)3)12-6-4-5-11-7-8-14(19)18(10,11)16(12)20/h4,6,10-15,19H,5,7-9H2,1-3H3/t10-,11-,12+,13-,14+,15+,18-/m1/s1 |
| InChIKey | SDWFOSCNYAGEIR-JGKJTGSKSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|