C9H20N2O4S2 — CID 114146780
N-[(3-aminocyclopentyl)methyl]-2-methylsulfonylethanesulfonamide (PubChem CID 114146780) has the molecular formula C9H20N2O4S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[(3-aminocyclopentyl)methyl]-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[(3-aminocyclopentyl)methyl]-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 114146780 |
| Molecular Formula | C9H20N2O4S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[(3-aminocyclopentyl)methyl]-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NCC1CCC(N)C1 |
| InChI | InChI=1S/C9H20N2O4S2/c1-16(12,13)4-5-17(14,15)11-7-8-2-3-9(10)6-8/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | BMUVQNHHDYFWBH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |