C17H24O3 — CID 11414714
(3aR,3bR,6aS,7aS)-3-(methoxymethoxymethyl)-2,3b-dimethyl-4-methylidene-1,3a,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-5-one (PubChem CID 11414714) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aR,3bR,6aS,7aS)-3-(methoxymethoxymethyl)-2,3b-dimethyl-4-methylidene-1,3a,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-5-one.
| Compound Name | (3aR,3bR,6aS,7aS)-3-(methoxymethoxymethyl)-2,3b-dimethyl-4-methylidene-1,3a,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-5-one |
|---|---|
| PubChem CID | 11414714 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3aR,3bR,6aS,7aS)-3-(methoxymethoxymethyl)-2,3b-dimethyl-4-methylidene-1,3a,6,6a,7,7a-hexahydrocyclopenta[a]pentalen-5-one |
| SMILES | C=C1C(=O)C[C@@H]2C[C@H]3CC(C)=C(COCOC)[C@H]3[C@]12C |
| InChI | InChI=1S/C17H24O3/c1-10-5-12-6-13-7-15(18)11(2)17(13,3)16(12)14(10)8-20-9-19-4/h12-13,16H,2,5-9H2,1,3-4H3/t12-,13+,16+,17-/m1/s1 |
| InChIKey | VASVSLGMIGHKFG-OSRSDYAFSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|