C14H18O4S — CID 11414864
(2R,3S,4S)-2-hydroxy-4-methyl-3-phenylsulfanylcarbonylhexanoic acid (PubChem CID 11414864) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is (2R,3S,4S)-2-hydroxy-4-methyl-3-phenylsulfanylcarbonylhexanoic acid.
| Compound Name | (2R,3S,4S)-2-hydroxy-4-methyl-3-phenylsulfanylcarbonylhexanoic acid |
|---|---|
| PubChem CID | 11414864 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R,3S,4S)-2-hydroxy-4-methyl-3-phenylsulfanylcarbonylhexanoic acid |
| SMILES | CC[C@H](C)[C@H](C(=O)Sc1ccccc1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H18O4S/c1-3-9(2)11(12(15)13(16)17)14(18)19-10-7-5-4-6-8-10/h4-9,11-12,15H,3H2,1-2H3,(H,16,17)/t9-,11-,12+/m0/s1 |
| InChIKey | RXUSOAAMCUPEJF-ZMLRMANQSA-N |
| XLogP | 2.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|