C10H20F3N3O — CID 114149042
1-(5-amino-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 114149042) has the molecular formula C10H20F3N3O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-(5-amino-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(5-amino-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 114149042 |
| Molecular Formula | C10H20F3N3O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-(5-amino-2,2-dimethylpentyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)(CCCN)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O/c1-9(2,4-3-5-14)6-15-8(17)16-7-10(11,12)13/h3-7,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | GDUHSSZODJKUSY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |