C12H25N5O — CID 114149085
1-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]-3-(dimethylamino)-2-methylpropan-2-ol (PubChem CID 114149085) has the molecular formula C12H25N5O and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]-3-(dimethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 114149085 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | 1-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]-3-(dimethylamino)-2-methylpropan-2-ol |
| SMILES | CCc1nn(C)c(NCC(C)(O)CN(C)C)c1N |
| InChI | InChI=1S/C12H25N5O/c1-6-9-10(13)11(17(5)15-9)14-7-12(2,18)8-16(3)4/h14,18H,6-8,13H2,1-5H3 |
| InChIKey | DHSVZUALPFTDHL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |