About 1-bromo-2-iodobenzene
1-bromo-2-iodobenzene (PubChem CID 11415) has the molecular formula C6H4BrI
and a molecular weight of 282.91 g/mol. Its IUPAC name is 1-bromo-2-iodobenzene.
Molecular Properties
| Compound Name | 1-bromo-2-iodobenzene |
| PubChem CID | 11415 |
| Molecular Formula | C6H4BrI |
| Molecular Weight | 282.91 g/mol |
| Exact Mass | 281.85 |
| IUPAC Name | 1-bromo-2-iodobenzene |
| SMILES | Brc1ccccc1I |
| InChI | InChI=1S/C6H4BrI/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | OIRHKGBNGGSCGS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-iodobenzene?
The IUPAC name of 1-bromo-2-iodobenzene (CID 11415) is 1-bromo-2-iodobenzene.
What is the SMILES notation for 1-bromo-2-iodobenzene?
The canonical SMILES for 1-bromo-2-iodobenzene is Brc1ccccc1I.
What is the InChIKey of 1-bromo-2-iodobenzene?
The InChIKey is OIRHKGBNGGSCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrI/c7-5-3-1-2-4-6(5)8/h1-4H.
What are the key properties of 1-bromo-2-iodobenzene?
1-bromo-2-iodobenzene has a molecular weight of 282.91 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-iodobenzene is sourced from PubChem (CID 11415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).