C12H20F2N4O — CID 114150408
5-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 114150408) has the molecular formula C12H20F2N4O and a molecular weight of 274.31 g/mol. Its IUPAC name is 5-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114150408 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 5-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C12H20F2N4O/c1-12(2,4-3-5-19)7-16-10-8(13)6-9(14)11(17-10)18-15/h6,19H,3-5,7,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | IUEFKSKPYQYRSL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|